191162-40-0 Usage
Description
1-METHYL-1H-INDOLE-2-BORONIC ACID 2,2-DIMETHYL PROPANE DIOL-1,3-CYCLIC ESTER is an organic compound that serves as a key intermediate in various chemical and pharmaceutical applications. It is characterized by its unique chemical structure, which includes an indole ring and a boronic acid functional group, making it a versatile building block for the synthesis of complex molecules.
Uses
Used in Pharmaceutical Industry:
1-METHYL-1H-INDOLE-2-BORONIC ACID 2,2-DIMETHYL PROPANE DIOL-1,3-CYCLIC ESTER is used as a pharmaceutical intermediate for the development of active pharmaceutical ingredients. Its unique structure allows for the creation of novel compounds with potential therapeutic applications.
Used in Organic Synthesis:
1-METHYL-1H-INDOLE-2-BORONIC ACID 2,2-DIMETHYL PROPANE DIOL-1,3-CYCLIC ESTER is used as a raw material in organic synthesis, where it can be employed to construct a wide range of complex organic molecules. Its reactivity and functional groups make it a valuable component in the synthesis of various compounds.
Used in Suzuki-Miyaura Coupling:
1-METHYL-1H-INDOLE-2-BORONIC ACID 2,2-DIMETHYL PROPANE DIOL-1,3-CYCLIC ESTER is used as a reactant in Suzuki-Miyaura coupling, a widely employed method for the formation of carbon-carbon bonds. This coupling reaction is particularly useful in the synthesis of biologically active compounds and materials with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 191162-40-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,1,1,6 and 2 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 191162-40:
(8*1)+(7*9)+(6*1)+(5*1)+(4*6)+(3*2)+(2*4)+(1*0)=120
120 % 10 = 0
So 191162-40-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BNO2/c1-11-8-5-3-2-4-7(8)6-9(11)10(12)13/h2-6,12-13H,1H3
191162-40-0Relevant articles and documents
JAK INHIBITOR
-
Page/Page column 79, (2009/10/21)
A JAK inhibitor comprising, as an active ingredient, a nitrogen-containing heterocyclic compound represented by formula (I) {wherein W represents a nitrogen atom or -CH-; X represents -C (=O) - or -CHR4- (wherein R4 represents a hydrogen atom, or the like); R1 represents the formula described below [wherein Q1 represents-CR8-(wherein R8 represents a hydrogen atom, substituted or unsubstituted lower alkyl, or the like); Q2 represents -NR15- (wherein R15 represents a hydrogen atom, substituted or unsubstituted lower alkyl, or the like); and R5 and R6 may be the same or different and each represents a hydrogen atom, halogen, carboxy, substituted or unsubstituted lower alkyl, or the like], or the like; and R2 and R3 may be the same or different and each represents a hydrogen atom, halogen, substituted or unsubstituted lower alkyl, or the like} or a pharmaceutically acceptable salt thereof.
3-PYRIDYLOXYMETHYL HETEROCYCLIC ETHER COMPOUNDS USEFUL IN CONTROLLING CHEMICAL SYNAPTIC TRANSMISSION
-
, (2008/06/13)
-
