19132-91-3 Usage
Description
Glucopyranosiduronic acid, 4-biphenylyl, beta-Dis a complex organic compound that is a derivative of glucuronic acid, featuring a biphenylyl group attached to it. This molecule is known for its unique structural properties and potential applications in various fields due to its chemical composition and interactions with other molecules.
Uses
Used in Pharmaceutical Industry:
Glucopyranosiduronic acid, 4-biphenylyl, beta-Dis used as an intermediate compound for the synthesis of various pharmaceutical agents. Its unique structure allows it to be a key component in the development of new drugs targeting specific receptors or biological pathways.
Used in Chemical Research:
In the field of chemical research, Glucopyranosiduronic acid, 4-biphenylyl, beta-Dserves as a valuable compound for studying the interactions between different molecular structures and their effects on biological systems. This can lead to a better understanding of various biological processes and the development of targeted therapies.
Used in Synthesis of Serotonin Receptor Agonists:
Glucopyranosiduronic acid, 4-biphenylyl, beta-Dis used as a metabolite in the synthesis of pyrrolo[1,2-c]imidazole dione derivatives, which are selective serotonin 5-HT1A receptor agonists. These agonists possess antinociceptive activity, making them potential candidates for the development of pain relief medications.
Used in Drug Metabolism Studies:
As a metabolite of 4-Phenylphenol, Glucopyranosiduronic acid, 4-biphenylyl, beta-Dcan be utilized in drug metabolism studies to understand the biotransformation processes of various compounds within the body. This knowledge can be applied to optimize drug design and improve the efficacy and safety of medications.
Check Digit Verification of cas no
The CAS Registry Mumber 19132-91-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,1,3 and 2 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 19132-91:
(7*1)+(6*9)+(5*1)+(4*3)+(3*2)+(2*9)+(1*1)=103
103 % 10 = 3
So 19132-91-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H18O7/c19-13-14(20)16(17(22)23)25-18(15(13)21)24-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,13-16,18-21H,(H,22,23)/t13-,14-,15+,16-,18+/m0/s1