19208-27-6 Usage
Description
1-ETHYL-2-([7-([3-ETHYL-1,3-BENZOTHIAZOL-2(3H)-YLIDENE]METHYL)-4,4A,5,6-TETRAHYDRO-2(3H)-NAPHTHALENYLIDENE]METHYL)NAPHTHO[1,2-D][1,3]THIAZOL-1-IUM IODIDE is a complex organic compound that belongs to the class of quaternary ammonium salts. It features a naphthalene ring system, a benzothiazole system, and an ethyl group, which contribute to its unique structure and properties. 1-ETHYL-2-([7-([3-ETHYL-1,3-BENZOTHIAZOL-2(3H)-YLIDENE]METHYL)-4,4A,5,6-TETRAHYDRO-2(3H)-NAPHTHALENYLIDENE]METHYL)NAPHTHO[1,2-D][1,3]THIAZOL-1-IUM IODIDE may have potential applications in various fields such as pharmaceuticals, organic synthesis, and materials science, but further research and analysis are required to fully understand its potential uses and effects.
Uses
Used in Pharmaceutical Industry:
1-ETHYL-2-([7-([3-ETHYL-1,3-BENZOTHIAZOL-2(3H)-YLIDENE]METHYL)-4,4A,5,6-TETRAHYDRO-2(3H)-NAPHTHALENYLIDENE]METHYL)NAPHTHO[1,2-D][1,3]THIAZOL-1-IUM IODIDE is used as a potential pharmaceutical compound for its unique structure and properties that may contribute to the development of new drugs and therapies.
Used in Organic Synthesis:
1-ETHYL-2-([7-([3-ETHYL-1,3-BENZOTHIAZOL-2(3H)-YLIDENE]METHYL)-4,4A,5,6-TETRAHYDRO-2(3H)-NAPHTHALENYLIDENE]METHYL)NAPHTHO[1,2-D][1,3]THIAZOL-1-IUM IODIDE is used as a key intermediate in organic synthesis for the production of other complex organic molecules with potential applications in various industries.
Used in Materials Science:
1-ETHYL-2-([7-([3-ETHYL-1,3-BENZOTHIAZOL-2(3H)-YLIDENE]METHYL)-4,4A,5,6-TETRAHYDRO-2(3H)-NAPHTHALENYLIDENE]METHYL)NAPHTHO[1,2-D][1,3]THIAZOL-1-IUM IODIDE is used in materials science for its unique structural properties that may contribute to the development of new materials with specific characteristics and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 19208-27-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,2,0 and 8 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 19208-27:
(7*1)+(6*9)+(5*2)+(4*0)+(3*8)+(2*2)+(1*7)=106
106 % 10 = 6
So 19208-27-6 is a valid CAS Registry Number.
InChI:InChI=1/C34H33N2S2.HI/c1-3-35-29-11-7-8-12-30(29)37-32(35)21-23-13-15-25-16-14-24(20-27(25)19-23)22-33-36(4-2)34-28-10-6-5-9-26(28)17-18-31(34)38-33;/h5-12,17-22,25H,3-4,13-16H2,1-2H3;1H/q+1;/p-1