19503-26-5 Usage
Description
1H-1,2,4-TRIAZOLE-1-CARBOXAMIDINE MONOHYDROCHLORIDE is a white crystalline compound that serves as an intermediate in the synthesis of various pharmaceuticals, particularly peramivir, an antiviral agent used for the treatment of influenza.
Uses
Used in Pharmaceutical Industry:
1H-1,2,4-TRIAZOLE-1-CARBOXAMIDINE MONOHYDROCHLORIDE is used as an intermediate in the synthesis of peramivir (P285500) for its antiviral properties against influenza. The compound plays a crucial role in the development of effective treatments for viral infections, contributing to the overall management and control of influenza outbreaks.
Check Digit Verification of cas no
The CAS Registry Mumber 19503-26-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,5,0 and 3 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 19503-26:
(7*1)+(6*9)+(5*5)+(4*0)+(3*3)+(2*2)+(1*6)=105
105 % 10 = 5
So 19503-26-5 is a valid CAS Registry Number.
InChI:InChI=1/C3H5N5.ClH/c4-3(5)8-2-6-1-7-8;/h1-2H,(H3,4,5);1H