1954-97-8 Usage
Description
5-NITRO-ISOPHTHALIC ACID MONOMETHYL AMIDE, also known as N-Methyl-5-nitro-isophthalamic Acid, is a chemical compound derived from isophthalamic acid. It is characterized by the presence of a nitro group and a methyl amide group, which contribute to its unique chemical properties and potential applications.
Uses
Used in Medical Imaging:
5-NITRO-ISOPHTHALIC ACID MONOMETHYL AMIDE is used as a contrast agent for x-ray imaging. Its chemical properties allow it to enhance the visibility of internal structures during x-ray procedures, providing clearer images for diagnostic purposes. This makes it a valuable tool in various medical applications, particularly in radiology and diagnostic imaging.
Check Digit Verification of cas no
The CAS Registry Mumber 1954-97-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,5 and 4 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1954-97:
(6*1)+(5*9)+(4*5)+(3*4)+(2*9)+(1*7)=108
108 % 10 = 8
So 1954-97-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O5/c1-10-8(12)5-2-6(9(13)14)4-7(3-5)11(15)16/h2-4H,1H3,(H,10,12)(H,13,14)
