19747-13-8 Usage
Description
(2Z)-3-(2-FURYL)-2-(5-PHENYL-1H-TETRAZOL-1-YL)ACRYLIC ACID is a chemical compound with the molecular formula C15H11N3O3. It is a derivative of acrylic acid, containing a furan ring and a tetrazole ring. (2Z)-3-(2-FURYL)-2-(5-PHENYL-1H-TETRAZOL-1-YL)ACRYLIC ACID is a potential ligand for metal ions and has been studied for its potential applications in coordination chemistry and as a building block for the synthesis of new organic molecules. Its structure and properties make it of interest to researchers in the fields of medicinal chemistry and material science. Further research on this compound may reveal its potential for various applications in the future.
Uses
Used in Coordination Chemistry:
(2Z)-3-(2-FURYL)-2-(5-PHENYL-1H-TETRAZOL-1-YL)ACRYLIC ACID is used as a potential ligand for metal ions, enabling the formation of coordination complexes that can be studied for their properties and potential applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (2Z)-3-(2-FURYL)-2-(5-PHENYL-1H-TETRAZOL-1-YL)ACRYLIC ACID is used as a building block for the synthesis of new organic molecules with potential therapeutic properties.
Used in Material Science:
(2Z)-3-(2-FURYL)-2-(5-PHENYL-1H-TETRAZOL-1-YL)ACRYLIC ACID is used in material science for the development of new materials with unique properties, such as improved stability or reactivity, based on its structure and characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 19747-13-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,7,4 and 7 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 19747-13:
(7*1)+(6*9)+(5*7)+(4*4)+(3*7)+(2*1)+(1*3)=138
138 % 10 = 8
So 19747-13-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H10N4O3/c19-14(20)12(9-11-7-4-8-21-11)18-13(15-16-17-18)10-5-2-1-3-6-10/h1-9H,(H,19,20)/p-1