19810-73-2 Usage
Description
2-(Dimethylamino)-6-methyl-3H-pyrimidin-4-one is an organic compound that serves as a key intermediate in the synthesis of various chemical products. It is characterized by its unique molecular structure, which features a pyrimidinone core with a dimethylamino group at the 2nd position and a methyl group at the 6th position.
Uses
Used in Pesticide Synthesis:
2-(Dimethylamino)-6-methyl-3H-pyrimidin-4-one is used as an intermediate in the synthesis of Pyrimitate (P997785), an organophosphorus pesticide. It plays a crucial role in the production process due to its ability to react with other chemical components to form the final pesticide product, which is effective in controlling a wide range of pests in agriculture.
If there are additional applications in different industries, they can be listed as follows:
Used in Pharmaceutical Industry:
2-(Dimethylamino)-6-methyl-3H-pyrimidin-4-one could potentially be used as a building block for the development of new pharmaceutical compounds, given its unique chemical structure. Its reactivity and functional groups may allow for the creation of novel drugs with specific therapeutic properties.
Used in Chemical Research:
2-(dimethylamino)-6-methyl-3H-pyrimidin-4-one may also find use in the field of chemical research, where it can be employed as a model compound to study various reaction mechanisms, synthetic strategies, and the development of new catalysts or methodologies.
Please note that the above additional uses are speculative and based on the compound's structural features. The actual applications may vary depending on the specific context and requirements of the industry or research field.
Check Digit Verification of cas no
The CAS Registry Mumber 19810-73-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,8,1 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 19810-73:
(7*1)+(6*9)+(5*8)+(4*1)+(3*0)+(2*7)+(1*3)=122
122 % 10 = 2
So 19810-73-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N3O/c1-5-4-6(11)9-7(8-5)10(2)3/h4H,1-3H3,(H,8,9,11)
