19957-52-9 Usage
Description
N,N-Diethyl-2-[p-(1,2-diphenylvinyl)phenoxy]ethylamine is a complex organic compound characterized by its unique molecular structure. It is composed of a central ethylamine group with two diethyl substituents and a phenoxy group attached to a p-phenylene linker, which is further connected to a 1,2-diphenylvinyl group. N,N-Diethyl-2-[p-(1,2-diphenylvinyl)phenoxy]ethylamine is known for its potential applications in various fields due to its structural properties and interactions with other molecules.
Uses
1. Used in Pharmaceutical Industry:
N,N-Diethyl-2-[p-(1,2-diphenylvinyl)phenoxy]ethylamine is used as a Clomiphene (C587025) analog for its estrogenic activity. It serves as a key component in the development of antifertility agents, contributing to the regulation of reproductive health and family planning.
2. Used in Chemical Synthesis:
Due to its unique structure, N,N-Diethyl-2-[p-(1,2-diphenylvinyl)phenoxy]ethylamine can be utilized as an intermediate in the synthesis of various organic compounds, particularly those with pharmaceutical or agrochemical applications. Its versatility in forming different types of chemical bonds allows it to be a valuable building block in the creation of novel molecules with specific functions.
3. Used in Research and Development:
The compound's structural features make it an interesting candidate for research in various scientific fields, such as medicinal chemistry, materials science, and supramolecular chemistry. It can be employed in the study of molecular recognition, self-assembly processes, and the development of new methodologies for chemical synthesis and analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 19957-52-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,9,5 and 7 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 19957-52:
(7*1)+(6*9)+(5*9)+(4*5)+(3*7)+(2*5)+(1*2)=159
159 % 10 = 9
So 19957-52-9 is a valid CAS Registry Number.
InChI:InChI=1/C26H29NO/c1-3-27(4-2)19-20-28-25-17-15-24(16-18-25)26(23-13-9-6-10-14-23)21-22-11-7-5-8-12-22/h5-18,21H,3-4,19-20H2,1-2H3
19957-52-9Relevant articles and documents
Stereoselective Nickel(II)-Catalyzed Addition of Aryl Grignards to Diphenylacetylene in the Synthesis of Zuclomiphene
Blazecka, Peter,Chung, Andrew,Emmett, Michael,Green, Stuart,Karadeolian, Avedis,Le Sueur, Richard,Patel, Dineshkumar,Rey, Allan,Souza, Fabio,Zhao, Yajun
, (2022/03/16)
Stereoselective synthesis of zuclomiphene was developed using nickel-catalyzed addition of 4-fluorophenylmagnesium bromide to 1,2-diphenylacetylene, followed by quenching with a chlorinating reagent. Since the aryl fluoride addition and chlorination reactions occur consecutively in one pot, the cis orientation of the two phenyl groups of 1,2-diphenylacetylene is conserved, leading to the highly selective synthesis of zuclomiphene. The use of the Grignard reagent resulted in the presence of bromide ions in the reaction mixture, which led to the formation of the bromo-analog of zuclomiphene. Alternative routes were then explored to overcome this issue to yield high-purity zuclomiphene.