199789-54-3 Usage
Description
3-METHYL-2-METHYLTHIO-4,7(3H,8H)-PTERIDINEDIONE, SODIUM SALT is a light yellow solid that serves as a useful synthetic intermediate in the chemical industry. It is a compound with a specific molecular structure that can be utilized in the creation of various other chemicals and pharmaceuticals.
Uses
Used in Pharmaceutical Industry:
3-METHYL-2-METHYLTHIO-4,7(3H,8H)-PTERIDINEDIONE, SODIUM SALT is used as a synthetic intermediate for the development of new pharmaceutical compounds. Its unique chemical structure allows it to be a key component in the synthesis of drugs with potential therapeutic applications.
Used in Chemical Industry:
In the chemical industry, 3-METHYL-2-METHYLTHIO-4,7(3H,8H)-PTERIDINEDIONE, SODIUM SALT is used as a synthetic intermediate for the production of various chemicals. Its light yellow solid form and specific chemical properties make it a valuable building block in the synthesis of a wide range of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 199789-54-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,9,7,8 and 9 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 199789-54:
(8*1)+(7*9)+(6*9)+(5*7)+(4*8)+(3*9)+(2*5)+(1*4)=233
233 % 10 = 3
So 199789-54-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N4O2S.Na/c1-12-7(14)5-6(11-8(12)15-2)10-4(13)3-9-5;/h3H,1-2H3,(H,10,13,14);/q;+1/p-1/rC8H7N4NaO2S/c1-11-7(15)5-6(10-8(11)16-2)12(13)4(14)3-9-5/h3H,1-2H3
