20028-60-8 Usage
General Description
4-Amino-6-Chloroquinoline is a synthetic compound classified under the quinoline group of compounds. Quinolines are heterocyclic compounds, consisting of a benzene ring fused to pyridine; in the case of 4-Amino-6-Chloroquinoline, it has an additional amino and chlorine group attached to it. This chemical is known for its various applications in fields such as medicine, chemistry, and biochemistry. Specifically, it serves as an important precursor in the synthesis of numerous pharmaceuticals and has potential antimicrobial, anti-inflammatory, and anticancer properties. However, like other chemicals, proper handling and disposal should be ensured due to potential health and environmental hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 20028-60-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,0,2 and 8 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 20028-60:
(7*2)+(6*0)+(5*0)+(4*2)+(3*8)+(2*6)+(1*0)=58
58 % 10 = 8
So 20028-60-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H7ClN2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-5H,(H2,11,12)