20086-06-0 Usage
General Description
Diosbulbin B is a naturally occurring compound found in the plant Dioscorea bulbifera, commonly known as the air potato. It is a diterpenoid compound with potential for medicinal use. Diosbulbin B has been studied for its anti-inflammatory and analgesic properties, making it a candidate for the treatment of various conditions such as arthritis and pain. Additionally, it has also been investigated for its potential anticancer activity. However,
Check Digit Verification of cas no
The CAS Registry Mumber 20086-06-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,0,8 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 20086-06:
(7*2)+(6*0)+(5*0)+(4*8)+(3*6)+(2*0)+(1*6)=70
70 % 10 = 0
So 20086-06-0 is a valid CAS Registry Number.
InChI:InChI=1/C19H20O6/c1-18-6-13(9-2-3-22-8-9)25-19(18)7-14(24-17(19)21)15-11-4-10(5-12(15)18)23-16(11)20/h2-3,8,10-15H,4-7H2,1H3/t10-,11+,12+,13+,14-,15+,18-,19?/m0/s1