20291-75-2 Usage
Description
1,2,8-Trimethylphenanthrene is a chemical compound that belongs to the class of polycyclic aromatic hydrocarbons (PAHs). It is an isomer of 1,2,6-Trimethylphenanthrene, which is a known persistent organic pollutant (POP). 1,2,8-TRIMETHYLPHENANTHRENE is characterized by its unique molecular structure, consisting of a phenanthrene core with three methyl groups attached at the 1, 2, and 8 positions.
Uses
1,2,8-Trimethylphenanthrene is used as a research compound for studying the properties and behavior of PAHs and their isomers. Its unique structure allows scientists to investigate the differences in chemical reactivity, environmental persistence, and potential health effects compared to other PAHs and their isomers.
Used in Environmental Chemistry Research:
1,2,8-Trimethylphenanthrene is used as a model compound in environmental chemistry research to understand the fate and transport of PAHs in the environment. This knowledge is crucial for assessing the potential risks associated with the release of these compounds into the environment and for developing strategies to mitigate their impact.
Used in Analytical Chemistry:
1,2,8-Trimethylphenanthrene is used as a reference material in analytical chemistry for the development and validation of methods for the detection and quantification of PAHs in various samples, such as air, water, and soil. Its unique properties make it a valuable tool for improving the accuracy and reliability of these analytical techniques.
Used in Toxicology Studies:
1,2,8-Trimethylphenanthrene is used in toxicology studies to investigate the potential health effects of exposure to PAHs and their isomers. This research is essential for understanding the mechanisms of toxicity and for establishing safety guidelines and regulations to protect human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 20291-75-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,2,9 and 1 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 20291-75:
(7*2)+(6*0)+(5*2)+(4*9)+(3*1)+(2*7)+(1*5)=82
82 % 10 = 2
So 20291-75-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H16/c1-11-7-8-17-15(13(11)3)10-9-14-12(2)5-4-6-16(14)17/h4-10H,1-3H3
