204845-95-4 Usage
Description
6-(Benzyloxy)-9-[(1S,3R,4S)-2-methylene-4-(phenylmethoxy)-3-[(phenylmethoxy)methyl]cyclopentyl]-9H-purine-2-amine is a complex organic compound with a unique molecular structure. It is characterized by its benzyloxy and phenylmethoxy groups, as well as its cyclopentyl and purine-2-amine moieties. 6-(Benzyloxy)-9-[(1S,3R,4S)-2-methylene-4-(phenylmethoxy)-3-[(phenylmethoxy)methyl]cyclopentyl]-9H-purine-2-amine has potential applications in various fields due to its unique chemical properties and interactions with other molecules.
Uses
1. Pharmaceutical Industry:
6-(Benzyloxy)-9-[(1S,3R,4S)-2-methylene-4-(phenylmethoxy)-3-[(phenylmethoxy)methyl]cyclopentyl]-9H-purine-2-amine is used as an intermediate in the synthesis of antiviral agents, specifically for the preparation of Entecavir (E558900). Entecavir is a nucleoside analog reverse transcriptase inhibitor (NRTI) used to treat chronic hepatitis B virus (HBV) infection.
2. Research and Development:
6-(Benzyloxy)-9-[(1S,3R,4S)-2-methylene-4-(phenylmethoxy)-3-[(phenylmethoxy)methyl]cyclopentyl]-9H-purine-2-amine may also be used in research and development for the discovery of new pharmaceuticals and therapeutic agents. Its unique structure and functional groups can be exploited to design and synthesize novel molecules with potential applications in various therapeutic areas.
3. Chemical Synthesis:
6-(Benzyloxy)-9-[(1S,3R,4S)-2-methylene-4-(phenylmethoxy)-3-[(phenylmethoxy)methyl]cyclopentyl]-9H-purine-2-amine can be used as a building block or starting material in the synthesis of more complex organic molecules, particularly in the fields of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 204845-95-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,4,8,4 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 204845-95:
(8*2)+(7*0)+(6*4)+(5*8)+(4*4)+(3*5)+(2*9)+(1*5)=134
134 % 10 = 4
So 204845-95-4 is a valid CAS Registry Number.
InChI:InChI=1/C33H33N5O3/c1-23-27(21-39-18-24-11-5-2-6-12-24)29(40-19-25-13-7-3-8-14-25)17-28(23)38-22-35-30-31(38)36-33(34)37-32(30)41-20-26-15-9-4-10-16-26/h2-16,22,27-29H,1,17-21H2,(H2,34,36,37)/t27-,28-,29-/m0/s1