20493-60-1 Usage
Description
5-Bromo-3-methyl-isothiazole is an organic compound characterized by its unique molecular structure, which features a bromine atom at the 5th position and a methyl group at the 3rd position on the isothiazole ring. 5-Bromo-3-methyl-isothiazole is known for its potential applications in various chemical and pharmaceutical processes due to its distinct chemical properties.
Uses
Used in Pharmaceutical Industry:
5-Bromo-3-methyl-isothiazole is used as a reagent for the synthesis of bioisostere derivatives, which serve as new inhibitors for matrix metalloproteinase 12 (MMP12). MMP12 plays a significant role in the occurrence of aneurysms, a condition where a blood vessel bulges or balloons due to weakened walls. By inhibiting MMP12, these bioisostere derivatives can potentially help in the development of treatments for aneurysm prevention and management.
Additionally, 5-Bromo-3-methyl-isothiazole is used as a reagent in the synthesis of γ-secretase modulators. γ-Secretase is an enzyme complex involved in the proteolytic processing of various membrane proteins, including the amyloid precursor protein (APP), which is associated with Alzheimer's disease. Modulating the activity of γ-secretase can have implications in the development of therapeutic strategies for neurodegenerative disorders, such as Alzheimer's.
Check Digit Verification of cas no
The CAS Registry Mumber 20493-60-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,4,9 and 3 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 20493-60:
(7*2)+(6*0)+(5*4)+(4*9)+(3*3)+(2*6)+(1*0)=91
91 % 10 = 1
So 20493-60-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H4BrNS/c1-3-2-4(5)7-6-3/h2H,1H3
