2055-23-4 Usage
Description
4-methylamino-1-pyridin-3-yl-butan-1-one, also known as an aminoacylpyridine, is a chemical compound characterized by a pyridine ring substituted at position 3 by a 4-(methylamino)butanoyl group. This molecule is of interest due to its potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
4-methylamino-1-pyridin-3-yl-butan-1-one is used as a building block for the development of new pharmaceutical compounds. Its unique structure allows for the creation of novel drugs with potential applications in treating various diseases and conditions.
Used in Chemical Synthesis:
In the field of chemical synthesis, 4-methylamino-1-pyridin-3-yl-butan-1-one serves as an intermediate or a key component in the synthesis of more complex molecules. Its versatile structure makes it a valuable asset in the development of new chemical entities with specific properties and functions.
Used in Research and Development:
4-methylamino-1-pyridin-3-yl-butan-1-one is used as a research tool in academic and industrial laboratories. Its unique chemical properties make it an interesting candidate for studying various biological and chemical processes, potentially leading to new discoveries and innovations.
Used in Material Science:
In material science, 4-methylamino-1-pyridin-3-yl-butan-1-one may be used as a component in the development of new materials with specific properties, such as improved conductivity, stability, or reactivity. Its incorporation into these materials could lead to advancements in various applications, including electronics, energy storage, and catalysis.
Synthesis Reference(s)
Journal of the American Chemical Society, 101, p. 7429, 1979 DOI: 10.1021/ja00518a062
Check Digit Verification of cas no
The CAS Registry Mumber 2055-23-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,0,5 and 5 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 2055-23:
(6*2)+(5*0)+(4*5)+(3*5)+(2*2)+(1*3)=54
54 % 10 = 4
So 2055-23-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O/c1-11-6-3-5-10(13)9-4-2-7-12-8-9/h2,4,7-8,11H,3,5-6H2,1H3
