2057-34-3 Usage
Description
4-(1-Butenyl pentenyl) pyridine, with the molecular formula C15H19N, is a heterocyclic aromatic compound characterized by the presence of a pyridine ring and two alkyl groups, specifically a butenyl and a pentenyl group. This unique structure endows it with distinctive aromatic properties.
Used in Flavor and Fragrance Industry:
4-(1-Butenyl pentenyl) pyridine is used as a flavoring agent for its unique and distinct aroma, enhancing the taste profiles of various food products.
4-(1-Butenyl pentenyl) pyridine is also used as a fragrance component in perfumes and other personal care products, contributing to their overall scent character.
Used in Pharmaceutical Research:
4-(1-Butenyl pentenyl) pyridine is studied for its potential therapeutic properties, such as antimicrobial and anti-inflammatory effects, indicating its possible use in the development of new medications.
Check Digit Verification of cas no
The CAS Registry Mumber 2057-34-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,0,5 and 7 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 2057-34:
(6*2)+(5*0)+(4*5)+(3*7)+(2*3)+(1*4)=63
63 % 10 = 3
So 2057-34-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H19N/c1-3-5-7-13(8-6-4-2)14-9-11-15-12-10-14/h3-6,9-13H,7-8H2,1-2H3/b5-3+,6-4+
