206559-45-7 Usage
General Description
4-Bromophenethylamine Hydrobromide is a chemical compound characterized by the presence of bromine, nitrogen, and hydrogen atoms alongside a phenethylamine backbone. It is often used in the synthesis of various chemical reactions, particularly in pharmaceutical and organic chemistry. The hydrobromide aspect denotes that it has been combined with hydrobromic acid, forming a salt which increases its stability and enhances its solubility, thus, aiding its utility in various chemical processes. Its properties such as reactivity, solubility, melting and boiling points depend on its specific structural components. Detailed safety and handling instructions should be adhered to during its use due to its potential reactivity and harm upon exposure.
Check Digit Verification of cas no
The CAS Registry Mumber 206559-45-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,6,5,5 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 206559-45:
(8*2)+(7*0)+(6*6)+(5*5)+(4*5)+(3*9)+(2*4)+(1*5)=137
137 % 10 = 7
So 206559-45-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H10BrN.BrH/c9-8-3-1-7(2-4-8)5-6-10;/h1-4H,5-6,10H2;1H
