20675-01-8 Usage
Family
Pyridoindole alkaloids
Source
Tabernaemontana macrocarpa
Pharmacological Activities
+ Anti-inflammatory
+ Analgesic
+ Neuroprotective
+ Anticancer (inhibits cancer cell growth)
Specific mechanisms of action and potential uses still being investigated.
Check Digit Verification of cas no
The CAS Registry Mumber 20675-01-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,6,7 and 5 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 20675-01:
(7*2)+(6*0)+(5*6)+(4*7)+(3*5)+(2*0)+(1*1)=88
88 % 10 = 8
So 20675-01-8 is a valid CAS Registry Number.
InChI:InChI=1/C24H31N3/c1-18(2)10-13-26-14-12-24-22(17-26)21-6-4-5-7-23(21)27(24)15-11-20-9-8-19(3)25-16-20/h4-9,16,18H,10-15,17H2,1-3H3