206761-65-1 Usage
General Description
(+)-4'-Fluorotartranilic acid is a chemical compound that belongs to the class of tartranilic acids. It is a fluorinated derivative of tartranilic acid, a compound that is commonly found in agricultural and pharmaceutical products. The chemical compound has potential applications in the field of medicinal chemistry and drug development due to its unique structural properties and potential therapeutic effects. However, further research is needed to fully understand its biological activity and potential uses. Overall, (+)-4'-fluorotartranilic acid is a promising compound with potential applications in various scientific and industrial fields.
Check Digit Verification of cas no
The CAS Registry Mumber 206761-65-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,6,7,6 and 1 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 206761-65:
(8*2)+(7*0)+(6*6)+(5*7)+(4*6)+(3*1)+(2*6)+(1*5)=131
131 % 10 = 1
So 206761-65-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H10FNO5/c11-5-1-3-6(4-2-5)12-9(15)7(13)8(14)10(16)17/h1-4,7-8,13-14H,(H,12,15)(H,16,17)/t7-,8-/m1/s1
