20845-16-3 Usage
General Description
H-Glu(Oall)-Oall p-Tosylate is a compound that consists of a glutamic acid derivative with two O-alllyloxycarbonyl protecting groups. It also has a p-tosylate functional group attached to the glutamic acid molecule. H-Glu(Oall)-Oall p-Tosylate is commonly used in peptide synthesis as a protecting group for the carboxyl group of glutamic acid, allowing for selective deprotection and further modification of the peptide chain. The p-tosylate group also serves as a leaving group during peptide bond formation. Overall, H-Glu(Oall)-Oall p-Tosylate plays a crucial role in the efficient and controlled assembly of peptides in chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 20845-16-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,8,4 and 5 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 20845-16:
(7*2)+(6*0)+(5*8)+(4*4)+(3*5)+(2*1)+(1*6)=93
93 % 10 = 3
So 20845-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H17NO4.C7H8O3S/c1-3-7-15-10(13)6-5-9(12)11(14)16-8-4-2;1-6-2-4-7(5-3-6)11(8,9)10/h3-4,9H,1-2,5-8,12H2;2-5H,1H3,(H,8,9,10)/t9-;/m0./s1