21037-25-2 Usage
Molecular structure
1-deoxy-1-[2-(phenylazo)-3,4-xylidino]-D-ribitol consists of a ribitol sugar molecule, a phenylazo group, and a xylidino group.
Type of compound
It is a synthetic chemical compound.
Potential applications
It has potential uses in the chemical and pharmaceutical industries.
Handling requirements
Due to its complex structure and potential reactivity, it requires careful handling.
Further research
Its specific properties and potential uses will depend on additional studies and research in the fields of organic chemistry and pharmaceutical sciences.
Check Digit Verification of cas no
The CAS Registry Mumber 21037-25-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,0,3 and 7 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 21037-25:
(7*2)+(6*1)+(5*0)+(4*3)+(3*7)+(2*2)+(1*5)=62
62 % 10 = 2
So 21037-25-2 is a valid CAS Registry Number.
InChI:InChI=1/C19H25N3O4/c1-12-8-9-15(20-10-16(24)19(26)17(25)11-23)18(13(12)2)22-21-14-6-4-3-5-7-14/h3-9,16-17,19-20,23-26H,10-11H2,1-2H3/b22-21+