21141-84-4 Usage
General Description
(H-CYS-VAL-OH)2 is a chemical compound consisting of two molecules of the dipeptide cysteinylvaline. Each molecule is made up of a cysteine amino acid bonded to a valine amino acid, with an additional hydroxyl group attached to the end. Cysteinylvaline is a naturally occurring dipeptide found in proteins and acts as a building block for larger protein structures. It plays a role in various biological processes, such as the synthesis of collagen, antioxidant defense, and the formation of connective tissues. The chemical structure of (H-CYS-VAL-OH)2 suggests its potential use in pharmaceuticals or as a research tool in studying protein structure and function.
Check Digit Verification of cas no
The CAS Registry Mumber 21141-84-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,1,4 and 1 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 21141-84:
(7*2)+(6*1)+(5*1)+(4*4)+(3*1)+(2*8)+(1*4)=64
64 % 10 = 4
So 21141-84-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H30N4O6S2/c1-7(2)11(15(23)24)19-13(21)9(17)5-27-28-6-10(18)14(22)20-12(8(3)4)16(25)26/h7-12H,5-6,17-18H2,1-4H3,(H,19,21)(H,20,22)(H,23,24)(H,25,26)