21163-42-8 Usage
Description
(3S)-3-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-4-methylsulfanyl-butanoyl] amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanyl -butanoyl]amino]-3-[[(1S)-1-carbamoyl-2-phenyl-ethyl]carbamoyl]propanoic acid is a complex peptide with multiple amino acid residues. It contains various functional groups, including carboxylic acid, amine, and thiol groups. (3S)-3-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-4-methylsulfanyl-butanoyl] amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanyl -butanoyl]amino]-3-[[(1S)-1-carbamoyl-2-phenyl-ethyl]carbamoyl]propano ic acid has a long and extremely specific structure, making it difficult to synthesize and characterize. Its precise biological activities and physiological roles have not been fully elucidated, but it likely plays a role in protein-protein interactions or enzymatic processes.
Uses
Used in Pharmaceutical Industry:
(3S)-3-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-4-methylsulfanyl-butanoyl] amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanyl -butanoyl]amino]-3-[[(1S)-1-carbamoyl-2-phenyl-ethyl]carbamoyl]propanoic acid is used as a potential therapeutic agent for various diseases due to its complex structure and functional groups. Its role in protein-protein interactions or enzymatic processes may provide novel treatment options for a range of conditions.
Used in Research and Development:
(3S)-3-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-4-methylsulfanyl-butanoyl] amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanyl -butanoyl]amino]-3-[[(1S)-1-carbamoyl-2-phenyl-ethyl]carbamoyl]propanoic acid is used as a research tool to study the structure and function of complex peptides. Its unique properties and potential biological activities make it an interesting subject for scientific investigation, contributing to the understanding of peptide chemistry and its applications.
Used in Drug Design and Development:
(3S)-3-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-4-methylsulfanyl-butanoyl] amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylsulfanyl -butanoyl]amino]-3-[[(1S)-1-carbamoyl-2-phenyl-ethyl]carbamoyl]propanoic acid is used as a template for designing new drugs with specific therapeutic properties. Its complex structure and functional groups can be modified to create novel compounds with improved pharmacological profiles, potentially leading to the development of new medications for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 21163-42-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,1,6 and 3 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 21163-42:
(7*2)+(6*1)+(5*1)+(4*6)+(3*3)+(2*4)+(1*2)=68
68 % 10 = 8
So 21163-42-8 is a valid CAS Registry Number.
InChI:InChI=1/C36H48N8O8S2/c1-53-14-12-24(37)33(49)40-20-30(45)41-28(17-22-19-39-25-11-7-6-10-23(22)25)35(51)42-26(13-15-54-2)34(50)44-29(18-31(46)47)36(52)43-27(32(38)48)16-21-8-4-3-5-9-21/h3-11,19,24,26-29,39H,12-18,20,37H2,1-2H3,(H2,38,48)(H,40,49)(H,41,45)(H,42,51)(H,43,52)(H,44,50)(H,46,47)/t24-,26-,27-,28-,29-/m0/s1
21163-42-8Relevant articles and documents
CHOLECYSTOKININ HEPTAPEPTIDE ANALOGUES WITH MULTIPLE MODIFICATION IN PEPTIDE CHAIN
Hlavacek, Jan,Pirkova, jana,Zertova, Miroslava,Pospisek, Jan,Maletinska, Lenka,Slaninova, Jirina
, p. 2761 - 2765 (2007/10/02)
Using solid phase synthesis we prepared the cholecystokinin fragment Boc-CCK-7 (Boc-Tyr(SO3-Na+)-Met-Gly-Trp-Met-Asp-Phe-NH2) Ia and its seven analogues Ib - Ih.In the analogues Ib and Ic the Met residue in the carboxyterminal part of the molecule was substituted for L- or D-PheMe3.In the analogues Id and Ie with Phe residue substituted by L- or D-PheMe3 the Neo was inserted in the place of this Met residue and in the analogues If and Ig, in addition to PheMe3 substitution in the carboxyterminus, both Met residues were replaced for Neo.This dual substitution for Met residues was also applied in the analogue Ih with coded Phe residue in the C-terminus.