21224-16-8 Usage
General Description
2-Benzothiazolamine,6-ethyl-(9CI) is an organic chemical compound with the molecular formula C9H9NS. It is a derivative of benzothiazole, which is a heterocyclic aromatic compound containing both sulfur and nitrogen atoms in its ring structure. This specific derivative of benzothiazole has an ethyl group attached at the 6th position of the molecule. 2-Benzothiazolamine,6-ethyl-(9CI) has potential applications in various fields including pharmaceuticals, agrochemicals, and dyes. It may also have use as an intermediate in the synthesis of other chemical compounds. Overall, this compound is of interest to researchers and industries due to its unique chemical structure and potential utility in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 21224-16-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,2,2 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 21224-16:
(7*2)+(6*1)+(5*2)+(4*2)+(3*4)+(2*1)+(1*6)=58
58 % 10 = 8
So 21224-16-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2S/c1-2-6-3-4-7-8(5-6)12-9(10)11-7/h3-5H,2H2,1H3,(H2,10,11)
