21415-94-1 Usage
Type of compound
Chemical compound
Common use
Pharmaceutical intermediate for the synthesis of potential drug candidates
Structural features
a. Phthalazine ring structure
b. Cyano group attached
c. Two diphenyl groups attached
Importance of cyano group
Versatile building block for the synthesis of various bioactive molecules
Role of diphenyl groups
Contribute to structural stability and reactivity
Potential applications
Pharmaceutical industry for the development of new drugs and therapeutic agents
Value for research
Unique structure and properties make it a valuable chemical compound for further research and development
Check Digit Verification of cas no
The CAS Registry Mumber 21415-94-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,4,1 and 5 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 21415-94:
(7*2)+(6*1)+(5*4)+(4*1)+(3*5)+(2*9)+(1*4)=81
81 % 10 = 1
So 21415-94-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H16N4O/c23-15-21-20-14-8-7-9-17(20)16-24-26(21)22(27)25(18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-14,16,21H