2147-83-3 Usage
Description
1,3-Dihydro-1-(1,2,3,6-tetrahydro-4-pyridinyl)-2H-benzimidazole-2-one is an organic compound with a light beige to beige powder appearance. It is characterized by its unique chemical structure, which features a benzimidazole core fused with a dihydropyridine ring. 1,3-Dihydro-1-(1,2,3,6-tetrahydro-4-pyridinyl)-2H-benzimidazole-2-one is known for its potential applications in the pharmaceutical industry, particularly in the development of anti-parkinsonic agents.
Uses
Used in Pharmaceutical Industry:
1,3-Dihydro-1-(1,2,3,6-tetrahydro-4-pyridinyl)-2H-benzimidazole-2-one is used as a reactant for the synthesis of potential anti-parkinsonic agents. Its unique chemical structure allows it to be a key component in the development of new drugs that target the treatment of Parkinson's disease, a neurodegenerative disorder that affects movement and motor control.
The compound's role in the synthesis process is crucial, as it can be further modified and combined with other molecules to create more complex and effective anti-parkinsonic agents. By understanding the compound's chemical properties and reactivity, researchers can design and synthesize novel drug candidates with improved efficacy and reduced side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 2147-83-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,4 and 7 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 2147-83:
(6*2)+(5*1)+(4*4)+(3*7)+(2*8)+(1*3)=73
73 % 10 = 3
So 2147-83-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N3O/c16-12-14-10-3-1-2-4-11(10)15(12)9-5-7-13-8-6-9/h1-5,13H,6-8H2,(H,14,16)/p+1
