21532-07-0 Usage
General Description
5-Methyl-1,2,4-triazole-3,4-diamine is a chemical compound that belongs to the class of triazole derivatives. It is commonly used as a building block in the synthesis of various pharmaceuticals, agrochemicals, and dyes. Its primary function is as an intermediate in the production of medicines, particularly antifungal and antiprotozoal drugs. Additionally, it is utilized in the manufacturing of corrosion inhibitors, metal chelating agents, and fluorescent whitening agents. The compound is known for its high thermal stability and is commonly used in industrial applications due to its resistance to heat and chemicals. Overall, 5-Methyl-1,2,4-triazole-3,4-diamine plays a crucial role in the production of a wide range of important products across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 21532-07-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,5,3 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 21532-07:
(7*2)+(6*1)+(5*5)+(4*3)+(3*2)+(2*0)+(1*7)=70
70 % 10 = 0
So 21532-07-0 is a valid CAS Registry Number.
InChI:InChI=1/C3H7N5/c1-2-6-7-3(4)8(2)5/h5H2,1H3,(H2,4,7)