2164-65-0 Usage
Description
2-Aminopyrimidine-4-carboxylic acid is a naturally occurring compound found in various organisms, including Gracilaria edulis and Gracilaria salicornia. It is characterized by its off-white to grey powdery appearance and is known for its role as a substrate of the enzyme lathyrine synthase and as a precursor of the pyrimidine moiety of the non-protein amino acid lathyrine.
Uses
Used in Pharmaceutical Industry:
2-Aminopyrimidine-4-carboxylic acid is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its role as a substrate for lathyrine synthase and a precursor in the formation of lathyrine makes it a valuable component in the development of new drugs and therapies.
Used in Research and Development:
In the field of research and development, 2-Aminopyrimidine-4-carboxylic acid serves as an essential compound for studying the mechanisms of enzyme-catalyzed reactions and the synthesis of pyrimidine-based molecules. This knowledge can be applied to create novel drugs and improve existing ones.
Used in Biochemical Studies:
2-Aminopyrimidine-4-carboxylic acid is utilized in biochemical studies to understand the structure and function of enzymes, such as lathyrine synthase, and their role in the biosynthesis of non-protein amino acids like lathyrine. This information can contribute to the advancement of biochemistry and molecular biology.
Used in Chemical Synthesis:
As a chemical intermediate, 2-Aminopyrimidine-4-carboxylic acid is employed in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structure and reactivity make it a versatile building block for creating a wide range of products.
Check Digit Verification of cas no
The CAS Registry Mumber 2164-65-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,6 and 4 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 2164-65:
(6*2)+(5*1)+(4*6)+(3*4)+(2*6)+(1*5)=70
70 % 10 = 0
So 2164-65-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N3O2/c6-5-7-2-1-3(8-5)4(9)10/h1-2H,(H,9,10)(H2,6,7,8)
