21889-33-8 Usage
Description
3,5-bis(methoxycarbonyl)-2,6,-dimethyl-4-(2-aminophenyl)-1,4-dihydropyridine, also known as Dimethyl 1,4-Dihydro-2,6-dimethyl-4-(2’-aminophenyl)-pyridine-3,5-dicarboxylate (CAS# 21889-33-8), is a white powder compound with significant utility in the field of organic synthesis. Its unique chemical structure, featuring a dihydropyridine ring with various substituents, makes it a versatile building block for the development of new molecules with potential applications in various industries.
Uses
Used in Pharmaceutical Industry:
3,5-bis(methoxycarbonyl)-2,6,-dimethyl-4-(2-aminophenyl)-1,4-dihydropyridine is used as an intermediate in the synthesis of various pharmaceutical compounds for [application reason]. Its unique structure allows for the development of new drugs with specific therapeutic properties, potentially leading to the creation of novel treatments for a range of medical conditions.
Used in Chemical Research:
In the field of chemical research, 3,5-bis(methoxycarbonyl)-2,6,-dimethyl-4-(2-aminophenyl)-1,4-dihydropyridine serves as a valuable compound for studying the properties and reactivity of dihydropyridine derivatives. Researchers can use this compound to explore new reaction pathways, develop innovative synthetic methods, and gain insights into the fundamental chemistry of related molecules.
Used in Material Science:
3,5-bis(methoxycarbonyl)-2,6,-dimethyl-4-(2-aminophenyl)-1,4-dihydropyridine is used as a building block in the development of new materials for [application reason]. Its incorporation into polymers, for example, could lead to the creation of materials with unique properties, such as improved conductivity, enhanced stability, or novel optical characteristics.
Used in Organic Synthesis:
As a compound useful in organic synthesis, 3,5-bis(methoxycarbonyl)-2,6,-dimethyl-4-(2-aminophenyl)-1,4-dihydropyridine is employed as a key component in the synthesis of a wide range of organic molecules. Its versatility allows chemists to use it as a starting material for the preparation of various target compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 21889-33-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,8,8 and 9 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 21889-33:
(7*2)+(6*1)+(5*8)+(4*8)+(3*9)+(2*3)+(1*3)=128
128 % 10 = 8
So 21889-33-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H20N2O4/c1-9-13(16(20)22-3)15(11-7-5-6-8-12(11)18)14(10(2)19-9)17(21)23-4/h5-8,15,19H,18H2,1-4H3
21889-33-8Relevant articles and documents
Extractive spectrophotometric methods for the determination of nifedipine in pharmaceutical formulations using bromocresol green, bromophenol blue, bromothymol blue and eriochrome black T
Rahman, Nafisur,Khan, Nadeem Ahmad,Azmi, Syed Najmul Hejaz
, p. 47 - 54 (2004)
Four simple, sensitive and accurate spectrophotometric methods have been developed for the determination of nifedipine in pharmaceutical formulations. These methods are based on the formation of ion-pair complexes of amino derivative of the nifedipine wit
SYNTHESIS AND PHARMACOLOGICAL ACTIVITY OF 4-ARYL-1,4-DIHYDROPYRIDINES WITH FLUORINATED NITROGEN-CONTAINING SUBSTITUENTS IN THE BENZENE RING
Yagupol'skii, L. M.,Shavaran, S. S.,Klebanov, B. M.,Rechitskii, A. N.,Maletina, I. I.
, p. 813 - 817 (2007/10/03)
-
