2190-27-4 Usage
Description
1-[[(1-oxohexadecyl)oxy]methyl]-2-[(1-oxooctadecyl)oxy]ethyl oleate is a complex ester compound characterized by its unique molecular structure. It consists of a central glycerol molecule with three fatty acid chains attached at different positions. Specifically, it has a hexadecanoic acid (palmitic acid) chain at the sn-1 position, an octadecanoic acid (stearic acid) chain at the sn-2 position, and an oleic acid chain at the sn-3 position. 1-[[(1-oxohexadecyl)oxy]methyl]-2-[(1-oxooctadecyl)oxy]ethyl oleate is known for its structural similarity to certain triacylglycerols, which are the main components of natural fats and oils.
Uses
1. Used in the Food Industry:
1-[[(1-oxohexadecyl)oxy]methyl]-2-[(1-oxooctadecyl)oxy]ethyl oleate is used as an additive for the improvement of chocolate, due to its structural similarity to 1-Palmitoyl-2-oleoyl-3-stearoyl-rac-glycerol, which is the major triacid triglyceride found in cocoa butter. 1-[[(1-oxohexadecyl)oxy]methyl]-2-[(1-oxooctadecyl)oxy]ethyl oleate enhances the texture, taste, and overall quality of chocolate products.
2. Used in the Cosmetics Industry:
This ester compound can be used as an ingredient in the formulation of cosmetics, particularly in creams and lotions, due to its emollient properties. It helps to moisturize and soften the skin, providing a smooth and supple feel.
3. Used in the Pharmaceutical Industry:
1-[[(1-oxohexadecyl)oxy]methyl]-2-[(1-oxooctadecyl)oxy]ethyl oleate may also find applications in the pharmaceutical industry, where it can be used as a carrier or excipient in the development of drug delivery systems. Its lipophilic nature allows for better solubility and absorption of certain drugs, potentially improving their bioavailability and efficacy.
4. Used in the Chemical Industry:
As a synthetic ester, 1-[[(1-oxohexadecyl)oxy]methyl]-2-[(1-oxooctadecyl)oxy]ethyl oleate can be utilized in various chemical processes, such as the production of lubricants, plasticizers, and other industrial chemicals. Its unique molecular structure may offer specific advantages in these applications, such as improved stability or performance.
Check Digit Verification of cas no
The CAS Registry Mumber 2190-27-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,9 and 0 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 2190-27:
(6*2)+(5*1)+(4*9)+(3*0)+(2*2)+(1*7)=64
64 % 10 = 4
So 2190-27-4 is a valid CAS Registry Number.
InChI:InChI=1/C55H104O6/c1-4-7-10-13-16-19-22-25-27-30-33-36-39-42-45-48-54(57)60-51-52(50-59-53(56)47-44-41-38-35-32-29-24-21-18-15-12-9-6-3)61-55(58)49-46-43-40-37-34-31-28-26-23-20-17-14-11-8-5-2/h26,28,52H,4-25,27,29-51H2,1-3H3/b28-26-