22026-39-7 Usage
Description
3,4-Methylenedioxybenzhydrazide is an organic compound with the molecular formula C8H8N2O2. It is characterized by the presence of a benzene ring with two oxygen atoms connected to adjacent carbon atoms in a methylene dioxy group, and a hydrazide functional group attached to the opposite end of the benzene ring. 3,4-METHYLENEDIOXYBENZHYDRAZIDE has potential applications in various fields due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
3,4-Methylenedioxybenzhydrazide is used as a chemical intermediate for the development of drug candidates targeting neglected diseases. Its unique structure allows for the creation of novel compounds with potential therapeutic effects against diseases that are often overlooked or lack effective treatments.
Used in Neglected Diseases Drug Development:
3,4-Methylenedioxybenzhydrazide is used as a key component in the development of new drug candidates for neglected diseases. Its incorporation into various chemical structures can lead to the discovery of novel therapeutic agents that can help address the unmet medical needs of patients suffering from these conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 22026-39-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,0,2 and 6 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 22026-39:
(7*2)+(6*2)+(5*0)+(4*2)+(3*6)+(2*3)+(1*9)=67
67 % 10 = 7
So 22026-39-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2O3/c9-10-8(11)5-1-2-6-7(3-5)13-4-12-6/h1-3H,4,9H2,(H,10,11)
