2209-72-5 Usage
Description
4-AMINO-6-HYDROXY-2-METHYL-5-NITROSOPYRIMIDINE, also known as 6-Amino-2-methyl-5-nitroso-4(3H)-pyrimidinone, is an organic compound with the molecular formula C5H5N5O2. It is a derivative of pyrimidine, a heterocyclic compound with potential applications in various fields due to its unique chemical properties and reactivity.
Uses
Used in Pharmaceutical Industry:
4-AMINO-6-HYDROXY-2-METHYL-5-NITROSOPYRIMIDINE is used as a key intermediate compound for the synthesis of novel potential inhibitors of mitogen and stress-activated protein kinase-1 (MSK-1). These MSK-1 inhibitors have potential applications in the development of new therapeutic strategies for various diseases, including cancer, due to their role in regulating cellular signaling pathways involved in cell growth, differentiation, and survival.
Check Digit Verification of cas no
The CAS Registry Mumber 2209-72-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,2,0 and 9 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 2209-72:
(6*2)+(5*2)+(4*0)+(3*9)+(2*7)+(1*2)=65
65 % 10 = 5
So 2209-72-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N4O2/c1-2-7-4(6)3(9-11)5(10)8-2/h1H3,(H3,6,7,8,10)