2215-21-6 Usage
Description
3,5-Diisopropylsalicylic acid, also known as 3,5-Diisopropyl-2-hydroxybenzoic acid, is a beige to grey crystalline powder with unique chemical properties. It is a versatile organic compound that serves as a key intermediate in the synthesis of various organic and inorganic compounds.
Uses
Used in Chemical Synthesis:
3,5-Diisopropylsalicylic acid is used as a starting reagent in the synthesis of 2,4-Diisopropyl-phenol at 200°C. It plays a crucial role in the preparation of this compound, which has various applications in the chemical industry.
Used in Coordination Chemistry:
3,5-Diisopropylsalicylic acid is used as a starting reagent in the synthesis of Zn(II) and Cd(II) carboxylate complexes. These complexes have potential applications in various fields, such as catalysis, materials science, and pharmaceuticals.
Used in Metal Complexes:
3,5-Diisopropyl-2-hydroxybenzoic acid plays the role of an OH-inactivating ligand in its complexes with copper(II). This property makes it a valuable component in the development of metal complexes with specific properties and potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 2215-21-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,2,1 and 5 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 2215-21:
(6*2)+(5*2)+(4*1)+(3*5)+(2*2)+(1*1)=46
46 % 10 = 6
So 2215-21-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H18O3/c1-7(2)9-5-10(8(3)4)12(14)11(6-9)13(15)16/h5-8,14H,1-4H3,(H,15,16)/p-1