22277-01-6 Usage
General Description
4-Chloro-5-nitro-7H-pyrrolo[2,3-d]pyrimidine is a chemical compound that belongs to the class of pyrrolopyrimidines. It is a heterocyclic compound containing a pyrrole ring fused to a pyrimidine ring with a chlorine atom at position 4 and a nitro group at position 5. 4-Chloro-5-nitro-7H-pyrrolo[2,3-d]pyrimidine has potential applications in pharmaceutical and agrochemical industries due to its biological activities. It can be used as a building block in the synthesis of various pharmaceutical drugs and agrochemicals. Its structure and properties make it a valuable intermediate in organic synthesis and drug discovery research. Additionally, it has been studied for its potential as an anti-cancer and anti-inflammatory agent.
Check Digit Verification of cas no
The CAS Registry Mumber 22277-01-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,2,7 and 7 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 22277-01:
(7*2)+(6*2)+(5*2)+(4*7)+(3*7)+(2*0)+(1*1)=86
86 % 10 = 6
So 22277-01-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H3ClN4O2/c7-5-4-3(11(12)13)1-8-6(4)10-2-9-5/h1-2H,(H,8,9,10)
