223671-54-3 Usage
General Description
1-chloroisoquinoline-5-carboxylic acid hydrochloride is a chemical compound with a complex structure, generally used in the field of organic chemistry and medicinal chemistry research. It is primarily used as a building block for the synthesis of more complex chemical structures, particularly in the production of certain pharmaceutical drugs. 1-chloroisoquinoline-5-carboxylic acid hydrochloride is a derivative of isoquinoline, a type of nitrogen-containing heterocycle, and features a carboxylic acid and a chloro group, suggesting it may have various biological activities. However, specific details of its properties and potential applications are subject to the particular chemical context and the other substances it is combined with.
Check Digit Verification of cas no
The CAS Registry Mumber 223671-54-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,3,6,7 and 1 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 223671-54:
(8*2)+(7*2)+(6*3)+(5*6)+(4*7)+(3*1)+(2*5)+(1*4)=123
123 % 10 = 3
So 223671-54-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H6ClNO2.ClH/c11-9-7-2-1-3-8(10(13)14)6(7)4-5-12-9;/h1-5H,(H,13,14);1H
223671-54-3Relevant articles and documents
Isoquinolines as urokinase inhibitors
-
, (2008/06/13)
Compounds of formula (I): and pharmaceutically acceptable salts thereof, wherein one of R1 and R2 is H and the other is N=C(NH2)2 or NHC(=NH)NH2, and the other substituents are as defined herein, are urokinase (uPA) inhibitors.
