22424-59-5 Usage
Description
5-BENZYLOXY-2-NITROPHENYLPYRUVIC ACID, also known as 3-(5-(Benzyloxy)-2-nitrophenyl)-2-oxopropanoic Acid, is an organic compound that serves as a valuable synthesis intermediate and building block in the field of organic synthesis. It is characterized by its unique chemical structure, which includes a benzyloxy group and a nitrophenyl moiety attached to a pyruvic acid backbone.
Uses
Used in Organic Synthesis:
5-BENZYLOXY-2-NITROPHENYLPYRUVIC ACID is used as a synthesis intermediate for the creation of various organic compounds. Its unique structure allows it to be a versatile building block in the synthesis of a wide range of molecules, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-BENZYLOXY-2-NITROPHENYLPYRUVIC ACID is used as a key intermediate in the development of new drugs. Its chemical properties make it suitable for the synthesis of various drug candidates, potentially leading to the discovery of novel therapeutic agents with improved efficacy and safety profiles.
Used in Agrochemical Industry:
5-BENZYLOXY-2-NITROPHENYLPYRUVIC ACID is also utilized in the agrochemical industry as a starting material for the synthesis of new pesticides and other crop protection agents. Its unique structure can be exploited to design and develop innovative agrochemicals with enhanced performance and selectivity.
Used in Specialty Chemicals:
In the specialty chemicals sector, 5-BENZYLOXY-2-NITROPHENYLPYRUVIC ACID is employed as a building block for the synthesis of various specialty chemicals, such as dyes, pigments, and additives. Its unique chemical structure can be tailored to meet the specific requirements of these applications, leading to the development of new and improved products.
Check Digit Verification of cas no
The CAS Registry Mumber 22424-59-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,4,2 and 4 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 22424-59:
(7*2)+(6*2)+(5*4)+(4*2)+(3*4)+(2*5)+(1*9)=85
85 % 10 = 5
So 22424-59-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H13NO6/c18-15(16(19)20)9-12-8-13(6-7-14(12)17(21)22)23-10-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,19,20)
