22504-50-3 Usage
Description
ETHYLENE GLYCOL BIS(3-MERCAPTOPROPIONATE) is a chemical compound characterized by its liquid state and unique solubility properties. It is insoluble in water and hexane but soluble in alcohol, acetone, and benzene. ETHYLENE GLYCOL BIS(3-MERCAPTOPROPIONATE) is also combustible and has a significant role in the design of processable shape memory polymer systems for biomedical applications.
Uses
Used in Biomedical Applications:
ETHYLENE GLYCOL BIS(3-MERCAPTOPROPIONATE) is used as a component in the design of processable shape memory polymer systems, which are crucial for various biomedical applications. These systems can be engineered to respond to specific stimuli, such as temperature or pH changes, making them versatile and adaptable for different medical needs.
Used in Polymer Industry:
ETHYLENE GLYCOL BIS(3-MERCAPTOPROPIONATE) is used as a cross-linking agent for polymers, particularly epoxy resins. Its ability to form covalent bonds between polymer chains enhances the mechanical properties and stability of the resulting materials, making it an essential component in the production of various polymer products.
Used as a Chemical Intermediate:
In the chemical industry, ETHYLENE GLYCOL BIS(3-MERCAPTOPROPIONATE) serves as an intermediate in the synthesis of other compounds. Its unique structure and reactivity make it a valuable building block for creating a wide range of products, from pharmaceuticals to specialty chemicals.
Flammability and Explosibility
Notclassified
Check Digit Verification of cas no
The CAS Registry Mumber 22504-50-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,5,0 and 4 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 22504-50:
(7*2)+(6*2)+(5*5)+(4*0)+(3*4)+(2*5)+(1*0)=73
73 % 10 = 3
So 22504-50-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O4S2/c9-7(1-5-13)11-3-4-12-8(10)2-6-14/h13-14H,1-6H2