22607-75-6 Usage
Description
4-AZATRICYCLO[4.3.1.1(3,8)]UNDECAN-5-ONE, also known as homoazaadamantanone, is a chemical compound formed during the Beckman rearrangement of adamantanone oxime. Its crystal structure has been studied, and it is known for its unique properties and potential applications in various fields.
Uses
Used in Chemical Synthesis:
4-AZATRICYCLO[4.3.1.1(3,8)]UNDECAN-5-ONE is used as an intermediate in the synthesis of various organic compounds. Its unique structure allows for the creation of a wide range of molecules with different properties and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-AZATRICYCLO[4.3.1.1(3,8)]UNDECAN-5-ONE is used as a building block for the development of new drugs. Its structural similarity to other bioactive molecules makes it a valuable candidate for drug design and optimization.
Used in Material Science:
4-AZATRICYCLO[4.3.1.1(3,8)]UNDECAN-5-ONE can be utilized in the development of new materials with specific properties, such as improved stability or enhanced reactivity. Its unique structure can contribute to the creation of advanced materials for various applications.
Used in Research and Development:
Due to its unique properties and potential applications, 4-AZATRICYCLO[4.3.1.1(3,8)]UNDECAN-5-ONE is used in research and development to explore new chemical reactions, mechanisms, and applications. It serves as a valuable tool for scientists and researchers in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 22607-75-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,6,0 and 7 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 22607-75:
(7*2)+(6*2)+(5*6)+(4*0)+(3*7)+(2*7)+(1*5)=96
96 % 10 = 6
So 22607-75-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H15NO/c12-10-8-2-6-1-7(3-8)5-9(4-6)11-10/h6-9H,1-5H2,(H,11,12)
22607-75-6Relevant articles and documents
SYNTHESIS AND TRANSFORMATIONS OF OXAZIRIDINES. ADAMANTANE-2-SPIRO-3'-OXAZIRIDINE AND ITS N-ALKYL DERIVATIVES
Novoselov, E. F.,Isaev, S. D.,Yurchenko, A. G.
, p. 97 - 103 (2007/10/02)
Unsubstituted and N-substituted adamantane-2-spiro-3'-oxaziridine were synthesized by the oxidation of Schiff bases, obtained from adamantanone and alkyl(aryl)amines, with peroxyacetic acid.The thermal rearrangement of the N-substituted derivatives leads to N-substituted 5-azahomoadamantan-4-ones, while fragmentation under the influence of Fe(II) ions leads to derivatives of bicyclononane in the form of N-substituted amides.Adamantane-2-spiro-3'-oxaziridine gives different transformation products, i.e., adamantanone in the first case and 5-azahomoadamantan-4-one in the second.