22694-55-9 Usage
Description
2,5-Dihydro-2-furan-2-carboxylic acid, also known as 2-furoic acid, is a heterocyclic carboxylic acid that is formed during the anaerobic decomposition of ascorbic acid. It is characterized by its unique chemical structure, which contributes to its various applications in different industries.
Uses
Used in Food Industry:
2,5-Dihydro-2-furan-2-carboxylic acid is used as a preservative and flavoring agent in the food industry. Its ability to enhance the taste and extend the shelf life of various food products makes it a valuable component in the production process.
Used in Pharmaceutical Industry:
2,5-Dihydro-2-furan-2-carboxylic acid is also utilized in the pharmaceutical industry for its potential therapeutic applications. Its unique chemical properties allow it to be used in the development of new drugs and treatments for various medical conditions.
Used in Chemical Synthesis:
In the field of chemical synthesis, 2,5-dihydro-2-furan-2-carboxylic acid serves as an important building block for the creation of various organic compounds. Its versatile structure enables it to be used in the synthesis of a wide range of molecules, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 22694-55-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,6,9 and 4 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 22694-55:
(7*2)+(6*2)+(5*6)+(4*9)+(3*4)+(2*5)+(1*5)=119
119 % 10 = 9
So 22694-55-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H6O3/c6-5(7)4-2-1-3-8-4/h1-2,4H,3H2,(H,6,7)
