22962-49-8 Usage
Description
5-METHYLBENZO[B]THIOPHENE-2-METHANOL is a chemical compound with a molecular formula C11H10OS. It is a derivative of benzo[b]thiophene, which is a heterocyclic compound containing a benzene ring fused to a thiophene ring. The addition of a methyl group and a hydroxyl group to the benzo[b]thiophene structure gives rise to 5-methylbenzo[b]thiophene-2-methanol.
Uses
Used in Organic Synthesis:
5-METHYLBENZO[B]THIOPHENE-2-METHANOL is used as a key intermediate in various organic synthesis reactions. Its unique structure allows for the formation of a wide range of chemical compounds, making it a valuable building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
5-METHYLBENZO[B]THIOPHENE-2-METHANOL is used as a starting material or intermediate in the development of pharmaceutical compounds. Its heterocyclic structure and functional groups make it a promising candidate for the synthesis of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
5-METHYLBENZO[B]THIOPHENE-2-METHANOL is used as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique chemical properties allow for the development of novel compounds with improved efficacy and selectivity in controlling pests and weeds.
Check Digit Verification of cas no
The CAS Registry Mumber 22962-49-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,9,6 and 2 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 22962-49:
(7*2)+(6*2)+(5*9)+(4*6)+(3*2)+(2*4)+(1*9)=118
118 % 10 = 8
So 22962-49-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H10OS/c1-7-2-3-10-8(4-7)5-9(6-11)12-10/h2-5,11H,6H2,1H3
