22982-78-1 Usage
Description
(Isopropyl)[(1,2,3,4-tetrahydro-6-methyl-7-nitro-2-quinolyl)methyl]ammonium methanesulphonate is a complex organic salt derived from the combination of isopropyl, 1,2,3,4-tetrahydro-6-methyl-7-nitro-2-quinolyl, methylammonium, and methanesulphonate. It possesses properties that make it useful in various chemical and biological processes, making it a versatile compound with a wide range of potential applications in scientific research and pharmaceutical development.
Uses
Used in Organic Synthesis:
(Isopropyl)[(1,2,3,4-tetrahydro-6-methyl-7-nitro-2-quinolyl)methyl]ammonium methanesulphonate is used as a reagent in organic synthesis for its ability to facilitate various chemical reactions and contribute to the formation of desired products.
Used in Biological Assays:
In the field of biology, (isopropyl)[(1,2,3,4-tetrahydro-6-methyl-7-nitro-2-quinolyl)methyl]ammonium methanesulphonate is used as a buffer to maintain stable conditions in assays, ensuring accurate and reliable results.
Used as a Biochemical Tool:
(isopropyl)[(1,2,3,4-tetrahydro-6-methyl-7-nitro-2-quinolyl)methyl]ammonium methanesulphonate is also utilized as a biochemical tool to study various biological processes, taking advantage of its unique properties to gain insights into cellular and molecular mechanisms.
Used in Pharmaceutical Development:
(Isopropyl)[(1,2,3,4-tetrahydro-6-methyl-7-nitro-2-quinolyl)methyl]ammonium methanesulphonate's potential applications in pharmaceutical development include its use in the creation of new drugs or drug candidates, as well as in the improvement of existing medications.
Used in Research and Development:
In the scientific research field, this compound is used to explore new methods and techniques, contributing to the advancement of knowledge in chemistry and biology.
Used in the Chemical Industry:
(Isopropyl)[(1,2,3,4-tetrahydro-6-methyl-7-nitro-2-quinolyl)methyl]ammonium methanesulphonate is employed in the chemical industry for its ability to enhance or enable specific chemical reactions, leading to the production of valuable compounds or materials.
Check Digit Verification of cas no
The CAS Registry Mumber 22982-78-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,9,8 and 2 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 22982-78:
(7*2)+(6*2)+(5*9)+(4*8)+(3*2)+(2*7)+(1*8)=131
131 % 10 = 1
So 22982-78-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H21N3O2.CH4O3S/c1-9(2)15-8-12-5-4-11-6-10(3)14(17(18)19)7-13(11)16-12;1-5(2,3)4/h6-7,9,12,15-16H,4-5,8H2,1-3H3;1H3,(H,2,3,4)
