23202-85-9 Usage
General Description
"(3R,4S)-3-[[4-(β-D-Glucopyranosyloxy)-3-methoxyphenyl]methyl]-4,5-dihydro-4-[(4-hydroxy-3-methoxyphenyl)methyl]furan-2(3H)-one" is a chemical compound with a complex structure containing a furan ring and multiple hydroxyl and methoxy substituents attached to phenyl and glucose moieties. It is likely a derivative of a natural product, given its structural complexity and the presence of glucose and methoxy groups, which are often found in phytochemicals. The compound may have potential biological activities, possibly related to its phenolic and furan functionalities, and could be of interest for pharmaceutical or agrochemical research. Further studies are needed to determine its specific properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 23202-85-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,2,0 and 2 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 23202-85:
(7*2)+(6*3)+(5*2)+(4*0)+(3*2)+(2*8)+(1*5)=69
69 % 10 = 9
So 23202-85-9 is a valid CAS Registry Number.
InChI:InChI=1/C26H32O11/c1-33-19-9-13(3-5-17(19)28)7-15-12-35-25(32)16(15)8-14-4-6-18(20(10-14)34-2)36-26-24(31)23(30)22(29)21(11-27)37-26/h3-6,9-10,15-16,21-24,26-31H,7-8,11-12H2,1-2H3/t15-,16+,21+,22+,23-,24+,26+/m0/s1