2339-78-8 Usage
Description
1,2-Dichloro-4-fluoro-5-nitrobenzene is an off-white powder with chemical properties that make it suitable for various applications in different industries. It is a compound that has been studied for its proton-detected local field (PDLF) spectra in nematic solvents.
Uses
Used in Chemical Synthesis:
1,2-Dichloro-4-fluoro-5-nitrobenzene is used as a key intermediate in the combinatorial solid-phase synthesis of bis-heterocyclic compounds. It serves as a solute to explore the potential of selective excitation in coupled multispin systems, which can be beneficial for the development of new chemical compounds and materials.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1,2-Dichloro-4-fluoro-5-nitrobenzene may be utilized as a building block for the development of new drugs, particularly those targeting specific biological pathways or receptors. Its unique chemical structure allows for the creation of novel molecules with potential therapeutic applications.
Used in Material Science:
1,2-Dichloro-4-fluoro-5-nitrobenzene can be employed in the development of new materials with specific properties, such as those with enhanced stability, reactivity, or selectivity. Its chemical structure can be manipulated to create materials with tailored characteristics for various applications, including sensors, catalysts, or advanced materials for energy storage and conversion.
Used in Research and Development:
As a compound with unique chemical properties, 1,2-Dichloro-4-fluoro-5-nitrobenzene is used in research and development to study its interactions with other molecules and its potential applications in various fields. This can lead to a better understanding of its properties and the discovery of new uses for this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 2339-78-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,3,3 and 9 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 2339-78:
(6*2)+(5*3)+(4*3)+(3*9)+(2*7)+(1*8)=88
88 % 10 = 8
So 2339-78-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H12FN3O5/c10-3-1-13(9(17)12-7(3)11)8-6(16)5(15)4(2-14)18-8/h1,4-6,8,14-16H,2H2,(H2,11,12,17)
