23656-67-9 Usage
Description
(2R,3S,4S)-2,3,4-trihydroxy-5-methylsulfanyl-pentanal, also known as D-ribose with the hydroxy group substituted for a methylthio group at position C-5, is a unique organic compound characterized by its distinct stereochemistry and functional groups. It is a chiral molecule with three asymmetric carbon centers, which gives it a specific three-dimensional arrangement. The presence of hydroxy and methylthio groups in its structure endows it with potential interactions with various biomolecules, making it a compound of interest for further research and development.
Uses
Used in Pharmaceutical Industry:
(2R,3S,4S)-2,3,4-trihydroxy-5-methylsulfanyl-pentanal is used as a chiral building block for the synthesis of various pharmaceutical compounds. Its unique stereochemistry and functional groups make it a valuable starting material for the development of new drugs with potential applications in treating different diseases.
Used in Chemical Research:
In the field of chemical research, (2R,3S,4S)-2,3,4-trihydroxy-5-methylsulfanyl-pentanal serves as a model compound for studying the effects of stereochemistry on molecular interactions and reactivity. It can be used to investigate the influence of chirality on biological activity and to develop new methods for the synthesis of enantiomerically pure compounds.
Used in Material Science:
(2R,3S,4S)-2,3,4-trihydroxy-5-methylsulfanyl-pentanal can be utilized as a component in the development of novel materials with specific properties. Its ability to form hydrogen bonds and interact with other molecules through its hydroxy and methylthio groups makes it a candidate for the design of new materials with tailored characteristics, such as improved solubility, stability, or biocompatibility.
Used in Analytical Chemistry:
As a chiral compound, (2R,3S,4S)-2,3,4-trihydroxy-5-methylsulfanyl-pentanal can be employed as a reference material for the development and validation of analytical methods, such as chiral chromatography and spectroscopy. It can help researchers to improve the separation and detection of enantiomers, which is crucial in various fields, including pharmaceuticals, environmental science, and food analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 23656-67-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,6,5 and 6 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 23656-67:
(7*2)+(6*3)+(5*6)+(4*5)+(3*6)+(2*6)+(1*7)=119
119 % 10 = 9
So 23656-67-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H12O4S/c1-11-3-5(9)6(10)4(8)2-7/h2,4-6,8-10H,3H2,1H3/t4-,5+,6-/m1/s1
