238401-54-2 Usage
Description
(-)-4'-FLUOROTARTRANILIC ACID is a chiral chemical compound derived from 4'-fluorotartrate, a natural product found in grapefruit. It possesses a specific spatial arrangement of atoms, leading to two mirror-image forms. (-)-4'-FLUOROTARTRANILIC ACID has potential pharmaceutical applications due to its inhibitory effects on enzymes involved in the biosynthesis of peptidoglycans, which are crucial for bacterial cell walls. Moreover, it has been considered as a building block in the synthesis of other chemical compounds with biological activity.
Used in Pharmaceutical Industry:
(-)-4'-FLUOROTARTRANILIC ACID is used as an enzyme inhibitor for its potential to inhibit certain enzymes involved in the biosynthesis of peptidoglycans, essential components of bacterial cell walls. This property makes it a candidate for the development of new antibiotics or antimicrobial agents.
Used in Chemical Synthesis:
(-)-4'-FLUOROTARTRANILIC ACID is used as a building block in the synthesis of other chemical compounds with biological activity. Its unique structure and properties make it a valuable component in creating new molecules with potential applications in various fields, including medicine, agriculture, and materials science.
Further research is necessary to fully explore the potential uses and applications of (-)-4'-FLUOROTARTRANILIC ACID in different industries and to understand its full scope of impact.
Check Digit Verification of cas no
The CAS Registry Mumber 238401-54-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,3,8,4,0 and 1 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 238401-54:
(8*2)+(7*3)+(6*8)+(5*4)+(4*0)+(3*1)+(2*5)+(1*4)=122
122 % 10 = 2
So 238401-54-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H10FNO5/c11-5-1-3-6(4-2-5)12-9(15)7(13)8(14)10(16)17/h1-4,7-8,13-14H,(H,12,15)(H,16,17)
