23931-59-1 Usage
Description
alpha-N-formyl-(epsilon-N-1-deoxy-1-fructosyl)-L-lysine, also known as a glyco-amino acid, is a unique compound consisting of a D-fructosyl residue attached to the epsilon-amino group of Nalpha-formyl-L-lysine. This structure grants it specific properties that make it valuable in various applications across different industries.
Uses
Used in Pharmaceutical Industry:
alpha-N-formyl-(epsilon-N-1-deoxy-1-fructosyl)-L-lysine is used as a key component in the development of pharmaceutical drugs for various medical conditions. Its unique structure allows for targeted drug delivery and enhanced bioavailability, making it an essential building block in the creation of novel therapeutic agents.
Used in Cosmetic Industry:
In the cosmetic industry, alpha-N-formyl-(epsilon-N-1-deoxy-1-fructosyl)-L-lysine is utilized as an active ingredient in skincare and beauty products due to its potential benefits for skin health and appearance. Its ability to interact with biopolymers and macromolecules may contribute to improved skin hydration, elasticity, and overall complexion.
Used in Food Industry:
alpha-N-formyl-(epsilon-N-1-deoxy-1-fructosyl)-L-lysine is also used in the food industry as a natural additive to enhance the nutritional value, taste, and shelf life of various products. Its unique properties may contribute to improved texture, flavor, and preservation, making it a valuable asset in the development of innovative food products.
Used in Research and Development:
Due to its unique structure and potential applications, alpha-N-formyl-(epsilon-N-1-deoxy-1-fructosyl)-L-lysine is a valuable compound for research and development in various scientific fields. It can be used as a model compound to study the interactions between biopolymers and macromolecules, leading to a better understanding of biological processes and the development of new technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 23931-59-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,9,3 and 1 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 23931-59:
(7*2)+(6*3)+(5*9)+(4*3)+(3*1)+(2*5)+(1*9)=111
111 % 10 = 1
So 23931-59-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H24N2O8/c16-6-10(19)12(21)11(20)9(18)5-14-4-2-1-3-8(13(22)23)15-7-17/h7-8,10-12,14,16,19-21H,1-6H2,(H,15,17)(H,22,23)/t8-,10-,11-,12-/m1/s1
