240-39-1 Usage
Class
Carbazole derivatives
12H-Pyrido[2,3-a]thieno[2,3-i]carbazole belongs to a group of chemical compounds derived from carbazole, which are known for their diverse biological activities and potential applications.
Structure
Polycyclic aromatic hydrocarbon with a fused pentacyclic ring system
The compound has a complex structure consisting of multiple interconnected rings, which contributes to its unique properties and potential applications.
Biological activities
Cytotoxic and anti-tumor properties
Studies have shown that 12H-Pyrido[2,3-a]thieno[2,3-i]carbazole exhibits potential cytotoxic effects on cancer cells and may have anti-tumor properties, making it a candidate for further research in cancer treatment.
Applications
Organic electronic devices
Due to its unique structural and electronic properties, 12H-Pyrido[2,3-a]thieno[2,3-i]carbazole has been explored for its potential use in the development of organic electronic devices, such as organic light-emitting diodes (OLEDs) and organic field-effect transistors (OFETs).
Environmental impact
Potential pollutant and marker for environmental monitoring
The compound has been investigated for its potential environmental impact as a pollutant and its possible use as a marker for monitoring environmental contamination.
Further research
Needed to fully understand properties and potential applications
More research is required to gain a comprehensive understanding of the properties and potential applications of 12H-Pyrido[2,3-a]thieno[2,3-i]carbazole, particularly in the areas of biological activities, environmental impact, and technological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 240-39-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 2,4 and 0 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 240-39:
(5*2)+(4*4)+(3*0)+(2*3)+(1*9)=41
41 % 10 = 1
So 240-39-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H10N2S/c1-2-10-3-4-12-11-5-6-14-13(7-9-20-14)16(11)19-17(12)15(10)18-8-1/h1-9,19H
