2409-52-1 Usage
Description
DIETHYL ITACONATE, also known as 2-Methylene-butanedioic acid 1,4-diethyl ester, is an organic compound commonly utilized in various chemical reactions and processes. It is characterized by its unique chemical structure, which allows it to participate in a range of reactions and contribute to the synthesis of different products.
Uses
Used in Organic Chemistry:
DIETHYL ITACONATE is used as a reactant in organic reactions for its ability to participate in the Diels-Alder reaction. This reaction is a significant process in organic chemistry, allowing for the formation of cyclic compounds from conjugated dienes and dienophiles, which can be further utilized in the synthesis of various complex molecules.
Used in Pharmaceutical Industry:
DIETHYL ITACONATE is used as an intermediate in the synthesis of pharmaceutical compounds for its versatility in chemical reactions. Its ability to form different products through various reaction pathways makes it a valuable component in the development of new drugs and medications.
Used in Polymer Industry:
DIETHYL ITACONATE is used as a monomer in the production of polymers for its potential to form polymer chains with unique properties. These polymers can be utilized in various applications, such as coatings, adhesives, and plastics, due to their specific characteristics.
Used in Material Science:
DIETHYL ITACONATE is used as a building block in the development of new materials for its ability to contribute to the formation of complex structures with desired properties. These materials can be applied in various fields, such as electronics, aerospace, and automotive industries, where specific material characteristics are required.
Check Digit Verification of cas no
The CAS Registry Mumber 2409-52-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,0 and 9 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 2409-52:
(6*2)+(5*4)+(4*0)+(3*9)+(2*5)+(1*2)=71
71 % 10 = 1
So 2409-52-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H14O4/c1-4-12-8(10)6-7(3)9(11)13-5-2/h3-6H2,1-2H3
2409-52-1Relevant articles and documents
A general approach to substituted itaconate esters
Dowd,Wilk
, p. 2307 - 2322 (1993)
A general approach to the synthesis of various itaconates including 3-substituted esters is presented. The complementarity of the approach is also shown.
A novel and practical method for the synthesis of dinotefuran through Michael addition of nitromethane to diethyl maleate
Li, Haifeng,Wang, Lailai
, p. 336 - 340 (2017/12/11)
A novel and practical synthesis of dinotefuran 1, featuring a new access to it from known key intermediate (tetrahydrofuran-3-yl)-methanamine 5, has been achieved through Michael addition reaction of nitromethane to diethyl maleate in 6 steps with 45.5% total yield. This synthesis is scalable and hence has high potential for application to further synthetic elaboration on such new neonicotinoid insecticide dinotefuran 1.
Highly chemoselective esterification reactions and Boc/THP/TBDMS discriminating deprotections under samarium(III) catalysis
Gopinath, Pushparathinam,Nilaya, Surapaneni,Muraleedharan, Kannoth Manheri
supporting information; experimental part, p. 1932 - 1935 (2011/06/21)
The usefulness of SmCl3 as an excellent catalyst for chemoselective esterifications and selective removal of acid sensitive protecting groups such as Boc, THP, and TBDMS in the presence of one another is demonstrated through suitable examples.
