2446-05-1 Usage
General Description
3-Methyl-5-oxo-pyrrolidine-2-carboxylic acid, also known as 3M5O2PCA, is a chemical compound with potential pharmaceutical applications. It is a derivative of pyrrolidine and is commonly used in the synthesis of pharmaceutical drugs and other bioactive compounds. 3-methyl-5-oxo-pyrrolidine-2-carboxylic acid exhibits both antimicrobial and antitumor activities, making it an important target for drug discovery and development. Its unique structure and biological activities make it a promising candidate for further research and potential therapeutic applications in the future.
Check Digit Verification of cas no
The CAS Registry Mumber 2446-05-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,4 and 6 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 2446-05:
(6*2)+(5*4)+(4*4)+(3*6)+(2*0)+(1*5)=71
71 % 10 = 1
So 2446-05-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H9NO3/c1-3-2-4(8)7-5(3)6(9)10/h3,5H,2H2,1H3,(H,7,8)(H,9,10)