244774-67-2 Usage
General Description
2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine platinum is a chemical compound that consists of a platinum atom coordinated to a porphyrin ligand. Porphyrins are a group of organic compounds that play a key role in biological processes such as oxygen transport and catalysis of various chemical reactions. The addition of platinum to the porphyrin molecule can enhance its reactivity and stability, making it useful for various applications in catalysis and as a photosensitizer in photodynamic therapy for cancer treatment. 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine platinum can also be used as a sensor for detecting various gases and toxins in the environment. The octaethyl substitution in the porphyrin ring can further modify its electronic and chemical properties, making it a versatile and potentially valuable compound for a range of scientific and medical purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 244774-67-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,4,7,7 and 4 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 244774-67:
(8*2)+(7*4)+(6*4)+(5*7)+(4*7)+(3*4)+(2*6)+(1*7)=162
162 % 10 = 2
So 244774-67-2 is a valid CAS Registry Number.
InChI:InChI=1/C36H46N4.Pt/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20,37,40H,9-16H2,1-8H3;/q;+2/b29-17-,30-18-,31-17-,32-18-,33-19-,34-20-,35-19-,36-20-;